C10H14N4O6S — CID 90073891
[(2R,5S)-2-(5-ethyl-1,3,4-oxadiazol-2-yl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 90073891) has the molecular formula C10H14N4O6S and a molecular weight of 318.31 g/mol. Its IUPAC name is [(2R,5S)-2-(5-ethyl-1,3,4-oxadiazol-2-yl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2R,5S)-2-(5-ethyl-1,3,4-oxadiazol-2-yl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 90073891 |
| Molecular Formula | C10H14N4O6S |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | [(2R,5S)-2-(5-ethyl-1,3,4-oxadiazol-2-yl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | CCc1nnc([C@H]2CC[C@H]3CN2C(=O)N3OS(=O)(=O)O)o1 |
| InChI | InChI=1S/C10H14N4O6S/c1-2-8-11-12-9(19-8)7-4-3-6-5-13(7)10(15)14(6)20-21(16,17)18/h6-7H,2-5H2,1H3,(H,16,17,18)/t6-,7+/m0/s1 |
| InChIKey | IHMMADHVXGVYEG-NKWVEPMBSA-N |
| XLogP | 0.31 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|