C18H27N3O3S3 — CID 90074173
2,4,6-tris(3-ethenoxypropylsulfanyl)-1,3,5-triazine (PubChem CID 90074173) has the molecular formula C18H27N3O3S3 and a molecular weight of 429.63 g/mol. Its IUPAC name is 2,4,6-tris(3-ethenoxypropylsulfanyl)-1,3,5-triazine.
| Compound Name | 2,4,6-tris(3-ethenoxypropylsulfanyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 90074173 |
| Molecular Formula | C18H27N3O3S3 |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 2,4,6-tris(3-ethenoxypropylsulfanyl)-1,3,5-triazine |
| SMILES | C=COCCCSc1nc(SCCCOC=C)nc(SCCCOC=C)n1 |
| InChI | InChI=1S/C18H27N3O3S3/c1-4-22-10-7-13-25-16-19-17(26-14-8-11-23-5-2)21-18(20-16)27-15-9-12-24-6-3/h4-6H,1-3,7-15H2 |
| InChIKey | ZKWGMIPKYDYWAJ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|