C15H24N6O6S3 — CID 90074450
3-[[4,6-bis[[3-(methoxyamino)-3-oxopropyl]sulfanyl]-1,3,5-triazin-2-yl]sulfanyl]-N-methoxypropanamide (PubChem CID 90074450) has the molecular formula C15H24N6O6S3 and a molecular weight of 480.59 g/mol. Its IUPAC name is 3-[[4,6-bis[[3-(methoxyamino)-3-oxopropyl]sulfanyl]-1,3,5-triazin-2-yl]sulfanyl]-N-methoxypropanamide.
| Compound Name | 3-[[4,6-bis[[3-(methoxyamino)-3-oxopropyl]sulfanyl]-1,3,5-triazin-2-yl]sulfanyl]-N-methoxypropanamide |
|---|---|
| PubChem CID | 90074450 |
| Molecular Formula | C15H24N6O6S3 |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 3-[[4,6-bis[[3-(methoxyamino)-3-oxopropyl]sulfanyl]-1,3,5-triazin-2-yl]sulfanyl]-N-methoxypropanamide |
| SMILES | CONC(=O)CCSc1nc(SCCC(=O)NOC)nc(SCCC(=O)NOC)n1 |
| InChI | InChI=1S/C15H24N6O6S3/c1-25-19-10(22)4-7-28-13-16-14(29-8-5-11(23)20-26-2)18-15(17-13)30-9-6-12(24)21-27-3/h4-9H2,1-3H3,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | MIKIXJQOSRINIU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|