C21H33NO4 — CID 90074551
2,5-bis(6-ethenoxyhexoxy)pyridine (PubChem CID 90074551) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is 2,5-bis(6-ethenoxyhexoxy)pyridine.
| Compound Name | 2,5-bis(6-ethenoxyhexoxy)pyridine |
|---|---|
| PubChem CID | 90074551 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 2,5-bis(6-ethenoxyhexoxy)pyridine |
| SMILES | C=COCCCCCCOc1ccc(OCCCCCCOC=C)nc1 |
| InChI | InChI=1S/C21H33NO4/c1-3-23-15-9-5-7-11-17-25-20-13-14-21(22-19-20)26-18-12-8-6-10-16-24-4-2/h3-4,13-14,19H,1-2,5-12,15-18H2 |
| InChIKey | YAJABVHRMNGJJL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 49.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|