About 6-[(2,6-dichlorophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one
6-[(2,6-dichlorophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one (PubChem CID 90074925) has the molecular formula C15H11Cl2NO3S2
and a molecular weight of 388.30 g/mol. Its IUPAC name is 6-[(2,6-dichlorophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one.
Molecular Properties
| Compound Name | 6-[(2,6-dichlorophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one |
| PubChem CID | 90074925 |
| Molecular Formula | C15H11Cl2NO3S2 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 386.96 |
| IUPAC Name | 6-[(2,6-dichlorophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one |
| SMILES | O=C1CSc2ccc(S(=O)(=O)Cc3c(Cl)cccc3Cl)cc2N1 |
| InChI | InChI=1S/C15H11Cl2NO3S2/c16-11-2-1-3-12(17)10(11)8-23(20,21)9-4-5-14-13(6-9)18-15(19)7-22-14/h1-6H,7-8H2,(H,18,19) |
| InChIKey | YLOAVHDOJOWKGG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[(2,6-dichlorophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2,6-dichlorophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one?
The IUPAC name of 6-[(2,6-dichlorophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one (CID 90074925) is 6-[(2,6-dichlorophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one.
What is the SMILES notation for 6-[(2,6-dichlorophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one?
The canonical SMILES for 6-[(2,6-dichlorophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one is O=C1CSc2ccc(S(=O)(=O)Cc3c(Cl)cccc3Cl)cc2N1.
What is the InChIKey of 6-[(2,6-dichlorophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one?
The InChIKey is YLOAVHDOJOWKGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2NO3S2/c16-11-2-1-3-12(17)10(11)8-23(20,21)9-4-5-14-13(6-9)18-15(19)7-22-14/h1-6H,7-8H2,(H,18,19).
What are the key properties of 6-[(2,6-dichlorophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one?
6-[(2,6-dichlorophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one has a molecular weight of 388.30 g/mol, XLogP of 4.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,6-dichlorophenyl)methylsulfonyl]-4H-1,4-benzothiazin-3-one is sourced from PubChem (CID 90074925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).