C9H15ClFNO2 — CID 90074971
(3R,4R,5R)-5-[(1S)-1-fluoroethyl]piperidine-3,4-dicarbaldehyde;hydrochloride (PubChem CID 90074971) has the molecular formula C9H15ClFNO2 and a molecular weight of 223.67 g/mol. Its IUPAC name is (3R,4R,5R)-5-[(1S)-1-fluoroethyl]piperidine-3,4-dicarbaldehyde;hydrochloride.
| Compound Name | (3R,4R,5R)-5-[(1S)-1-fluoroethyl]piperidine-3,4-dicarbaldehyde;hydrochloride |
|---|---|
| PubChem CID | 90074971 |
| Molecular Formula | C9H15ClFNO2 |
| Molecular Weight | 223.67 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (3R,4R,5R)-5-[(1S)-1-fluoroethyl]piperidine-3,4-dicarbaldehyde;hydrochloride |
| SMILES | C[C@H](F)[C@H]1CNC[C@H](C=O)[C@H]1C=O.Cl |
| InChI | InChI=1S/C9H14FNO2.ClH/c1-6(10)8-3-11-2-7(4-12)9(8)5-13;/h4-9,11H,2-3H2,1H3;1H/t6-,7+,8+,9+;/m0./s1 |
| InChIKey | IMTATGQDUGZMAP-WWTDWBKBSA-N |
| XLogP | 0.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.67 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|