About 3-(difluoromethyl)-4,5-bis(4-hydroxybutyl)piperidine-1-carboxamide
3-(difluoromethyl)-4,5-bis(4-hydroxybutyl)piperidine-1-carboxamide (PubChem CID 90075057) has the molecular formula C15H28F2N2O3
and a molecular weight of 322.40 g/mol. Its IUPAC name is 3-(difluoromethyl)-4,5-bis(4-hydroxybutyl)piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-4,5-bis(4-hydroxybutyl)piperidine-1-carboxamide |
| PubChem CID | 90075057 |
| Molecular Formula | C15H28F2N2O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 3-(difluoromethyl)-4,5-bis(4-hydroxybutyl)piperidine-1-carboxamide |
| SMILES | NC(=O)N1CC(CCCCO)C(CCCCO)C(C(F)F)C1 |
| InChI | InChI=1S/C15H28F2N2O3/c16-14(17)13-10-19(15(18)22)9-11(5-1-3-7-20)12(13)6-2-4-8-21/h11-14,20-21H,1-10H2,(H2,18,22) |
| InChIKey | YVHZVHIYJNSFOG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(difluoromethyl)-4,5-bis(4-hydroxybutyl)piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-4,5-bis(4-hydroxybutyl)piperidine-1-carboxamide?
The IUPAC name of 3-(difluoromethyl)-4,5-bis(4-hydroxybutyl)piperidine-1-carboxamide (CID 90075057) is 3-(difluoromethyl)-4,5-bis(4-hydroxybutyl)piperidine-1-carboxamide.
What is the SMILES notation for 3-(difluoromethyl)-4,5-bis(4-hydroxybutyl)piperidine-1-carboxamide?
The canonical SMILES for 3-(difluoromethyl)-4,5-bis(4-hydroxybutyl)piperidine-1-carboxamide is NC(=O)N1CC(CCCCO)C(CCCCO)C(C(F)F)C1.
What is the InChIKey of 3-(difluoromethyl)-4,5-bis(4-hydroxybutyl)piperidine-1-carboxamide?
The InChIKey is YVHZVHIYJNSFOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28F2N2O3/c16-14(17)13-10-19(15(18)22)9-11(5-1-3-7-20)12(13)6-2-4-8-21/h11-14,20-21H,1-10H2,(H2,18,22).
What are the key properties of 3-(difluoromethyl)-4,5-bis(4-hydroxybutyl)piperidine-1-carboxamide?
3-(difluoromethyl)-4,5-bis(4-hydroxybutyl)piperidine-1-carboxamide has a molecular weight of 322.40 g/mol, XLogP of 1.82, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-4,5-bis(4-hydroxybutyl)piperidine-1-carboxamide is sourced from PubChem (CID 90075057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).