C18H32N2O7 — CID 90075085
tert-butyl (4R)-4-[(4R,5R)-5-[methoxy(methyl)carbamoyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 90075085) has the molecular formula C18H32N2O7 and a molecular weight of 388.46 g/mol. Its IUPAC name is tert-butyl (4R)-4-[(4R,5R)-5-[methoxy(methyl)carbamoyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[(4R,5R)-5-[methoxy(methyl)carbamoyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 90075085 |
| Molecular Formula | C18H32N2O7 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | tert-butyl (4R)-4-[(4R,5R)-5-[methoxy(methyl)carbamoyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CON(C)C(=O)[C@@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H32N2O7/c1-16(2,3)27-15(22)20-11(10-24-17(20,4)5)12-13(14(21)19(8)23-9)26-18(6,7)25-12/h11-13H,10H2,1-9H3/t11-,12-,13-/m1/s1 |
| InChIKey | VCIHTDMFJWWKQK-JHJVBQTASA-N |
| XLogP | 1.90 |
| TPSA | 86.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|