C17H21IN2O2 — CID 90075086
2-[(3aR,4S,6S,6aS)-5-benzyl-4-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]acetonitrile (PubChem CID 90075086) has the molecular formula C17H21IN2O2 and a molecular weight of 412.27 g/mol. Its IUPAC name is 2-[(3aR,4S,6S,6aS)-5-benzyl-4-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]acetonitrile.
| Compound Name | 2-[(3aR,4S,6S,6aS)-5-benzyl-4-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]acetonitrile |
|---|---|
| PubChem CID | 90075086 |
| Molecular Formula | C17H21IN2O2 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 2-[(3aR,4S,6S,6aS)-5-benzyl-4-(iodomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-6-yl]acetonitrile |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](CI)N(Cc1ccccc1)[C@H]2CC#N |
| InChI | InChI=1S/C17H21IN2O2/c1-17(2)21-15-13(8-9-19)20(14(10-18)16(15)22-17)11-12-6-4-3-5-7-12/h3-7,13-16H,8,10-11H2,1-2H3/t13-,14+,15-,16+/m0/s1 |
| InChIKey | MOKGUNLCAOHDHF-XUWVNRHRSA-N |
| XLogP | 3.11 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|