C19H24N2O4 — CID 90075163
[(3aR,4R,6S,6aS)-5-benzyl-6-(cyanomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl acetate (PubChem CID 90075163) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is [(3aR,4R,6S,6aS)-5-benzyl-6-(cyanomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl acetate.
| Compound Name | [(3aR,4R,6S,6aS)-5-benzyl-6-(cyanomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl acetate |
|---|---|
| PubChem CID | 90075163 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | [(3aR,4R,6S,6aS)-5-benzyl-6-(cyanomethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@H](CC#N)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H24N2O4/c1-13(22)23-12-16-18-17(24-19(2,3)25-18)15(9-10-20)21(16)11-14-7-5-4-6-8-14/h4-8,15-18H,9,11-12H2,1-3H3/t15-,16+,17-,18+/m0/s1 |
| InChIKey | SMWZYGAHHPBSHD-XWTMOSNGSA-N |
| XLogP | 2.24 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |