About [(3R)-10,10-dibromo-3-methyldec-9-en-1-ynyl]-triethylsilane
[(3R)-10,10-dibromo-3-methyldec-9-en-1-ynyl]-triethylsilane (PubChem CID 90075409) has the molecular formula C17H30Br2Si
and a molecular weight of 422.32 g/mol. Its IUPAC name is [(3R)-10,10-dibromo-3-methyldec-9-en-1-ynyl]-triethylsilane.
Molecular Properties
| Compound Name | [(3R)-10,10-dibromo-3-methyldec-9-en-1-ynyl]-triethylsilane |
| PubChem CID | 90075409 |
| Molecular Formula | C17H30Br2Si |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | [(3R)-10,10-dibromo-3-methyldec-9-en-1-ynyl]-triethylsilane |
| SMILES | CC[Si](C#C[C@H](C)CCCCCC=C(Br)Br)(CC)CC |
| InChI | InChI=1S/C17H30Br2Si/c1-5-20(6-2,7-3)15-14-16(4)12-10-8-9-11-13-17(18)19/h13,16H,5-12H2,1-4H3/t16-/m1/s1 |
| InChIKey | DUCOORXIHZINHN-MRXNPFEDSA-N |
| XLogP | 7.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-10,10-dibromo-3-methyldec-9-en-1-ynyl]-triethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-10,10-dibromo-3-methyldec-9-en-1-ynyl]-triethylsilane?
The IUPAC name of [(3R)-10,10-dibromo-3-methyldec-9-en-1-ynyl]-triethylsilane (CID 90075409) is [(3R)-10,10-dibromo-3-methyldec-9-en-1-ynyl]-triethylsilane.
What is the SMILES notation for [(3R)-10,10-dibromo-3-methyldec-9-en-1-ynyl]-triethylsilane?
The canonical SMILES for [(3R)-10,10-dibromo-3-methyldec-9-en-1-ynyl]-triethylsilane is CC[Si](C#C[C@H](C)CCCCCC=C(Br)Br)(CC)CC.
What is the InChIKey of [(3R)-10,10-dibromo-3-methyldec-9-en-1-ynyl]-triethylsilane?
The InChIKey is DUCOORXIHZINHN-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H30Br2Si/c1-5-20(6-2,7-3)15-14-16(4)12-10-8-9-11-13-17(18)19/h13,16H,5-12H2,1-4H3/t16-/m1/s1.
What are the key properties of [(3R)-10,10-dibromo-3-methyldec-9-en-1-ynyl]-triethylsilane?
[(3R)-10,10-dibromo-3-methyldec-9-en-1-ynyl]-triethylsilane has a molecular weight of 422.32 g/mol, XLogP of 7.26, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-10,10-dibromo-3-methyldec-9-en-1-ynyl]-triethylsilane is sourced from PubChem (CID 90075409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).