About 2-ethylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate
2-ethylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate (PubChem CID 90075787) has the molecular formula C24H28FNO2S
and a molecular weight of 413.56 g/mol. Its IUPAC name is 2-ethylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate.
Molecular Properties
| Compound Name | 2-ethylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate |
| PubChem CID | 90075787 |
| Molecular Formula | C24H28FNO2S |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 2-ethylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate |
| SMILES | CCCCC(CC)COC(=O)CCSc1ccc(-c2ccc(C#N)cc2)c(F)c1 |
| InChI | InChI=1S/C24H28FNO2S/c1-3-5-6-18(4-2)17-28-24(27)13-14-29-21-11-12-22(23(25)15-21)20-9-7-19(16-26)8-10-20/h7-12,15,18H,3-6,13-14,17H2,1-2H3 |
| InChIKey | VVGPXTGMYUUMDU-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate?
The IUPAC name of 2-ethylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate (CID 90075787) is 2-ethylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate.
What is the SMILES notation for 2-ethylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate?
The canonical SMILES for 2-ethylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate is CCCCC(CC)COC(=O)CCSc1ccc(-c2ccc(C#N)cc2)c(F)c1.
What is the InChIKey of 2-ethylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate?
The InChIKey is VVGPXTGMYUUMDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28FNO2S/c1-3-5-6-18(4-2)17-28-24(27)13-14-29-21-11-12-22(23(25)15-21)20-9-7-19(16-26)8-10-20/h7-12,15,18H,3-6,13-14,17H2,1-2H3.
What are the key properties of 2-ethylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate?
2-ethylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate has a molecular weight of 413.56 g/mol, XLogP of 6.61, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 3-[4-(4-cyanophenyl)-3-fluorophenyl]sulfanylpropanoate is sourced from PubChem (CID 90075787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).