About 1,4-dimethyl-5,6-di(propan-2-yl)-2,3-dihydropyrazine
1,4-dimethyl-5,6-di(propan-2-yl)-2,3-dihydropyrazine (PubChem CID 90075872) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 1,4-dimethyl-5,6-di(propan-2-yl)-2,3-dihydropyrazine.
Molecular Properties
| Compound Name | 1,4-dimethyl-5,6-di(propan-2-yl)-2,3-dihydropyrazine |
| PubChem CID | 90075872 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1,4-dimethyl-5,6-di(propan-2-yl)-2,3-dihydropyrazine |
| SMILES | CC(C)C1=C(C(C)C)N(C)CCN1C |
| InChI | InChI=1S/C12H24N2/c1-9(2)11-12(10(3)4)14(6)8-7-13(11)5/h9-10H,7-8H2,1-6H3 |
| InChIKey | YBRUKOHFPPEMJP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dimethyl-5,6-di(propan-2-yl)-2,3-dihydropyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-5,6-di(propan-2-yl)-2,3-dihydropyrazine?
The IUPAC name of 1,4-dimethyl-5,6-di(propan-2-yl)-2,3-dihydropyrazine (CID 90075872) is 1,4-dimethyl-5,6-di(propan-2-yl)-2,3-dihydropyrazine.
What is the SMILES notation for 1,4-dimethyl-5,6-di(propan-2-yl)-2,3-dihydropyrazine?
The canonical SMILES for 1,4-dimethyl-5,6-di(propan-2-yl)-2,3-dihydropyrazine is CC(C)C1=C(C(C)C)N(C)CCN1C.
What is the InChIKey of 1,4-dimethyl-5,6-di(propan-2-yl)-2,3-dihydropyrazine?
The InChIKey is YBRUKOHFPPEMJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-9(2)11-12(10(3)4)14(6)8-7-13(11)5/h9-10H,7-8H2,1-6H3.
What are the key properties of 1,4-dimethyl-5,6-di(propan-2-yl)-2,3-dihydropyrazine?
1,4-dimethyl-5,6-di(propan-2-yl)-2,3-dihydropyrazine has a molecular weight of 196.34 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-5,6-di(propan-2-yl)-2,3-dihydropyrazine is sourced from PubChem (CID 90075872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).