C13H26N2 — CID 90075920
4,5,6-tri(propan-2-yl)-2,3-dihydro-1H-pyrazine (PubChem CID 90075920) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 4,5,6-tri(propan-2-yl)-2,3-dihydro-1H-pyrazine.
| Compound Name | 4,5,6-tri(propan-2-yl)-2,3-dihydro-1H-pyrazine |
|---|---|
| PubChem CID | 90075920 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 4,5,6-tri(propan-2-yl)-2,3-dihydro-1H-pyrazine |
| SMILES | CC(C)C1=C(C(C)C)N(C(C)C)CCN1 |
| InChI | InChI=1S/C13H26N2/c1-9(2)12-13(10(3)4)15(11(5)6)8-7-14-12/h9-11,14H,7-8H2,1-6H3 |
| InChIKey | RLAKOCSCBBXYRO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |