C16H24N2O — CID 90075922
1,2,3-tri(propan-2-yl)pyrido[2,3-b][1,4]oxazine (PubChem CID 90075922) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 1,2,3-tri(propan-2-yl)pyrido[2,3-b][1,4]oxazine.
| Compound Name | 1,2,3-tri(propan-2-yl)pyrido[2,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 90075922 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 1,2,3-tri(propan-2-yl)pyrido[2,3-b][1,4]oxazine |
| SMILES | CC(C)C1=C(C(C)C)N(C(C)C)c2cccnc2O1 |
| InChI | InChI=1S/C16H24N2O/c1-10(2)14-15(11(3)4)19-16-13(8-7-9-17-16)18(14)12(5)6/h7-12H,1-6H3 |
| InChIKey | PGWXUWFPCIEMLI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |