About 3-phenyl-2,7a-dihydro-1H-indazole
3-phenyl-2,7a-dihydro-1H-indazole (PubChem CID 90076023) has the molecular formula C13H12N2
and a molecular weight of 196.25 g/mol. Its IUPAC name is 3-phenyl-2,7a-dihydro-1H-indazole.
Molecular Properties
| Compound Name | 3-phenyl-2,7a-dihydro-1H-indazole |
| PubChem CID | 90076023 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 3-phenyl-2,7a-dihydro-1H-indazole |
| SMILES | C1=CC2=C(c3ccccc3)NNC2C=C1 |
| InChI | InChI=1S/C13H12N2/c1-2-6-10(7-3-1)13-11-8-4-5-9-12(11)14-15-13/h1-9,12,14-15H |
| InChIKey | RRSACECSQPINBV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-2,7a-dihydro-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2,7a-dihydro-1H-indazole?
The IUPAC name of 3-phenyl-2,7a-dihydro-1H-indazole (CID 90076023) is 3-phenyl-2,7a-dihydro-1H-indazole.
What is the SMILES notation for 3-phenyl-2,7a-dihydro-1H-indazole?
The canonical SMILES for 3-phenyl-2,7a-dihydro-1H-indazole is C1=CC2=C(c3ccccc3)NNC2C=C1.
What is the InChIKey of 3-phenyl-2,7a-dihydro-1H-indazole?
The InChIKey is RRSACECSQPINBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2/c1-2-6-10(7-3-1)13-11-8-4-5-9-12(11)14-15-13/h1-9,12,14-15H.
What are the key properties of 3-phenyl-2,7a-dihydro-1H-indazole?
3-phenyl-2,7a-dihydro-1H-indazole has a molecular weight of 196.25 g/mol, XLogP of 2.00, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2,7a-dihydro-1H-indazole is sourced from PubChem (CID 90076023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).