C17H26O3Si — CID 90076438
3',4,5-trimethyl-2'-(2-trimethylsilylethynyl)spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-ol (PubChem CID 90076438) has the molecular formula C17H26O3Si and a molecular weight of 306.48 g/mol. Its IUPAC name is 3',4,5-trimethyl-2'-(2-trimethylsilylethynyl)spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-ol.
| Compound Name | 3',4,5-trimethyl-2'-(2-trimethylsilylethynyl)spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-ol |
|---|---|
| PubChem CID | 90076438 |
| Molecular Formula | C17H26O3Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 3',4,5-trimethyl-2'-(2-trimethylsilylethynyl)spiro[1,3-dioxolane-2,5'-bicyclo[4.1.0]hept-3-ene]-2'-ol |
| SMILES | CC1=CC2(OC(C)C(C)O2)C2CC2C1(O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C17H26O3Si/c1-11-10-17(19-12(2)13(3)20-17)15-9-14(15)16(11,18)7-8-21(4,5)6/h10,12-15,18H,9H2,1-6H3 |
| InChIKey | RXSNYGZOODJNOS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|