C20H26BN3O5 — CID 90076630
[(1R)-1-[[(2S,3R)-3-hydroxy-2-[(6-phenylpyridine-2-carbonyl)amino]butanoyl]amino]-2-methylpropyl]boronic acid (PubChem CID 90076630) has the molecular formula C20H26BN3O5 and a molecular weight of 399.26 g/mol. Its IUPAC name is [(1R)-1-[[(2S,3R)-3-hydroxy-2-[(6-phenylpyridine-2-carbonyl)amino]butanoyl]amino]-2-methylpropyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S,3R)-3-hydroxy-2-[(6-phenylpyridine-2-carbonyl)amino]butanoyl]amino]-2-methylpropyl]boronic acid |
|---|---|
| PubChem CID | 90076630 |
| Molecular Formula | C20H26BN3O5 |
| Molecular Weight | 399.26 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | [(1R)-1-[[(2S,3R)-3-hydroxy-2-[(6-phenylpyridine-2-carbonyl)amino]butanoyl]amino]-2-methylpropyl]boronic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](NC(=O)c1cccc(-c2ccccc2)n1)[C@@H](C)O)B(O)O |
| InChI | InChI=1S/C20H26BN3O5/c1-12(2)18(21(28)29)24-20(27)17(13(3)25)23-19(26)16-11-7-10-15(22-16)14-8-5-4-6-9-14/h4-13,17-18,25,28-29H,1-3H3,(H,23,26)(H,24,27)/t13-,17+,18+/m1/s1 |
| InChIKey | HOFVHGJBXZZACL-BVGQSLNGSA-N |
| XLogP | 0.38 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|