C6H10N4 — CID 90076722
1,2,5,6,7,8-hexahydropteridine (PubChem CID 90076722) has the molecular formula C6H10N4 and a molecular weight of 138.17 g/mol. Its IUPAC name is 1,2,5,6,7,8-hexahydropteridine.
| Compound Name | 1,2,5,6,7,8-hexahydropteridine |
|---|---|
| PubChem CID | 90076722 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 1,2,5,6,7,8-hexahydropteridine |
| SMILES | C1=NCNC2=C1NCCN2 |
| InChI | InChI=1S/C6H10N4/c1-2-9-6-5(8-1)3-7-4-10-6/h3,8-10H,1-2,4H2 |
| InChIKey | KWYJQDXEGAJNNQ-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |