About CID 90076854
CID 90076854 (PubChem CID 90076854) has the molecular formula C41H46BBrN2O
and a molecular weight of 673.55 g/mol.
Molecular Properties
| Compound Name | CID 90076854 |
| PubChem CID | 90076854 |
| Molecular Formula | C41H46BBrN2O |
| Molecular Weight | 673.55 g/mol |
| Exact Mass | 672.29 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(C2(c3cccc(Br)n3)c3cc4c(cc3Oc3cc5c(cc32)C(C)(C)C(C)(C)C5(C)C)C(C)(C)C(C)(C)C4(C)C)n1 |
| InChI | InChI=1S/C41H46BBrN2O/c1-35(2)23-19-27-29(21-25(23)37(5,6)39(35,9)10)46-30-22-26-24(36(3,4)40(11,12)38(26,7)8)20-28(30)41(27,31-15-13-17-33(42)44-31)32-16-14-18-34(43)45-32/h13-22H,1-12H3 |
| InChIKey | HWBRRYZDDCRVFL-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 673.55 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 90076854 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90076854?
The IUPAC name of CID 90076854 (CID 90076854) is not available.
What is the SMILES notation for CID 90076854?
The canonical SMILES for CID 90076854 is [B]c1cccc(C2(c3cccc(Br)n3)c3cc4c(cc3Oc3cc5c(cc32)C(C)(C)C(C)(C)C5(C)C)C(C)(C)C(C)(C)C4(C)C)n1.
What is the InChIKey of CID 90076854?
The InChIKey is HWBRRYZDDCRVFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C41H46BBrN2O/c1-35(2)23-19-27-29(21-25(23)37(5,6)39(35,9)10)46-30-22-26-24(36(3,4)40(11,12)38(26,7)8)20-28(30)41(27,31-15-13-17-33(42)44-31)32-16-14-18-34(43)45-32/h13-22H,1-12H3.
What are the key properties of CID 90076854?
CID 90076854 has a molecular weight of 673.55 g/mol, XLogP of 9.71, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90076854 is sourced from PubChem (CID 90076854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).