C53H52N2O — CID 90076871
2-[2,7-ditert-butyl-9-[6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-2-pyridinyl]xanthen-9-yl]-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)pyridine (PubChem CID 90076871) has the molecular formula C53H52N2O and a molecular weight of 733.01 g/mol. Its IUPAC name is 2-[2,7-ditert-butyl-9-[6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-2-pyridinyl]xanthen-9-yl]-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)pyridine.
| Compound Name | 2-[2,7-ditert-butyl-9-[6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-2-pyridinyl]xanthen-9-yl]-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)pyridine |
|---|---|
| PubChem CID | 90076871 |
| Molecular Formula | C53H52N2O |
| Molecular Weight | 733.01 g/mol |
| Exact Mass | 732.41 |
| IUPAC Name | 2-[2,7-ditert-butyl-9-[6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-2-pyridinyl]xanthen-9-yl]-6-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)pyridine |
| SMILES | CC(C)(C)c1ccc2c(c1)C(c1cccc(-c3ccc4c(c3)C3CCC4C3)n1)(c1cccc(-c3ccc4c(c3)C3CCC4C3)n1)c1cc(C(C)(C)C)ccc1O2 |
| InChI | InChI=1S/C53H52N2O/c1-51(2,3)37-19-23-47-43(29-37)53(44-30-38(52(4,5)6)20-24-48(44)56-47,49-11-7-9-45(54-49)35-17-21-39-31-13-15-33(25-31)41(39)27-35)50-12-8-10-46(55-50)36-18-22-40-32-14-16-34(26-32)42(40)28-36/h7-12,17-24,27-34H,13-16,25-26H2,1-6H3 |
| InChIKey | YOZICGLMPHWVRV-UHFFFAOYSA-N |
| XLogP | 13.62 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.01 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |