C61H72N2O — CID 90076879
2-[2,7-ditert-butyl-9-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-pyridinyl]xanthen-9-yl]-6-(1,1,2,2,3,3-hexamethylinden-5-yl)pyridine (PubChem CID 90076879) has the molecular formula C61H72N2O and a molecular weight of 849.26 g/mol. Its IUPAC name is 2-[2,7-ditert-butyl-9-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-pyridinyl]xanthen-9-yl]-6-(1,1,2,2,3,3-hexamethylinden-5-yl)pyridine.
| Compound Name | 2-[2,7-ditert-butyl-9-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-pyridinyl]xanthen-9-yl]-6-(1,1,2,2,3,3-hexamethylinden-5-yl)pyridine |
|---|---|
| PubChem CID | 90076879 |
| Molecular Formula | C61H72N2O |
| Molecular Weight | 849.26 g/mol |
| Exact Mass | 848.56 |
| IUPAC Name | 2-[2,7-ditert-butyl-9-[6-(1,1,2,2,3,3-hexamethylinden-5-yl)-2-pyridinyl]xanthen-9-yl]-6-(1,1,2,2,3,3-hexamethylinden-5-yl)pyridine |
| SMILES | CC(C)(C)c1ccc2c(c1)C(c1cccc(-c3ccc4c(c3)C(C)(C)C(C)(C)C4(C)C)n1)(c1cccc(-c3ccc4c(c3)C(C)(C)C(C)(C)C4(C)C)n1)c1cc(C(C)(C)C)ccc1O2 |
| InChI | InChI=1S/C61H72N2O/c1-53(2,3)39-27-31-49-45(35-39)61(46-36-40(54(4,5)6)28-32-50(46)64-49,51-23-19-21-47(62-51)37-25-29-41-43(33-37)57(11,12)59(15,16)55(41,7)8)52-24-20-22-48(63-52)38-26-30-42-44(34-38)58(13,14)60(17,18)56(42,9)10/h19-36H,1-18H3 |
| InChIKey | CAHCUOMNEHJNCM-UHFFFAOYSA-N |
| XLogP | 16.08 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.26 |
| LogP ≤ 5 | 16.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |