C44H47N5O3 — CID 90076901
1-[2-[4-(5-tert-butyl-1,3-benzoxazol-2-yl)-5-hexoxy-2-methylphenyl]-1,3-benzoxazol-4-yl]-N,N-bis(pyridin-2-ylmethyl)methanamine (PubChem CID 90076901) has the molecular formula C44H47N5O3 and a molecular weight of 693.89 g/mol. Its IUPAC name is 1-[2-[4-(5-tert-butyl-1,3-benzoxazol-2-yl)-5-hexoxy-2-methylphenyl]-1,3-benzoxazol-4-yl]-N,N-bis(pyridin-2-ylmethyl)methanamine.
| Compound Name | 1-[2-[4-(5-tert-butyl-1,3-benzoxazol-2-yl)-5-hexoxy-2-methylphenyl]-1,3-benzoxazol-4-yl]-N,N-bis(pyridin-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 90076901 |
| Molecular Formula | C44H47N5O3 |
| Molecular Weight | 693.89 g/mol |
| Exact Mass | 693.37 |
| IUPAC Name | 1-[2-[4-(5-tert-butyl-1,3-benzoxazol-2-yl)-5-hexoxy-2-methylphenyl]-1,3-benzoxazol-4-yl]-N,N-bis(pyridin-2-ylmethyl)methanamine |
| SMILES | CCCCCCOc1cc(-c2nc3c(CN(Cc4ccccn4)Cc4ccccn4)cccc3o2)c(C)cc1-c1nc2cc(C(C)(C)C)ccc2o1 |
| InChI | InChI=1S/C44H47N5O3/c1-6-7-8-13-23-50-40-26-35(30(2)24-36(40)43-47-37-25-32(44(3,4)5)19-20-38(37)51-43)42-48-41-31(15-14-18-39(41)52-42)27-49(28-33-16-9-11-21-45-33)29-34-17-10-12-22-46-34/h9-12,14-22,24-26H,6-8,13,23,27-29H2,1-5H3 |
| InChIKey | XGEHEAKSMZRIIC-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 90.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.89 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|