C26H24N2O — CID 90076977
7,7,8,8-tetramethyl-2,3-diphenylfuro[2,3-g]quinoxaline (PubChem CID 90076977) has the molecular formula C26H24N2O and a molecular weight of 380.49 g/mol. Its IUPAC name is 7,7,8,8-tetramethyl-2,3-diphenylfuro[2,3-g]quinoxaline.
| Compound Name | 7,7,8,8-tetramethyl-2,3-diphenylfuro[2,3-g]quinoxaline |
|---|---|
| PubChem CID | 90076977 |
| Molecular Formula | C26H24N2O |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 7,7,8,8-tetramethyl-2,3-diphenylfuro[2,3-g]quinoxaline |
| SMILES | CC1(C)Oc2cc3nc(-c4ccccc4)c(-c4ccccc4)nc3cc2C1(C)C |
| InChI | InChI=1S/C26H24N2O/c1-25(2)19-15-20-21(16-22(19)29-26(25,3)4)28-24(18-13-9-6-10-14-18)23(27-20)17-11-7-5-8-12-17/h5-16H,1-4H3 |
| InChIKey | JQHXIGMSICBQIZ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |