C23H36N2 — CID 90077035
1-[(3E,5Z)-4,6-dimethylocta-3,5,7-trien-3-yl]-2-methyl-3-(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)imidazolidine (PubChem CID 90077035) has the molecular formula C23H36N2 and a molecular weight of 340.56 g/mol. Its IUPAC name is 1-[(3E,5Z)-4,6-dimethylocta-3,5,7-trien-3-yl]-2-methyl-3-(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)imidazolidine.
| Compound Name | 1-[(3E,5Z)-4,6-dimethylocta-3,5,7-trien-3-yl]-2-methyl-3-(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)imidazolidine |
|---|---|
| PubChem CID | 90077035 |
| Molecular Formula | C23H36N2 |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.29 |
| IUPAC Name | 1-[(3E,5Z)-4,6-dimethylocta-3,5,7-trien-3-yl]-2-methyl-3-(2,4,6-trimethylcyclohexa-1,3-dien-1-yl)imidazolidine |
| SMILES | C=C/C(C)=C\C(C)=C(/CC)N1CCN(C2=C(C)C=C(C)CC2C)C1C |
| InChI | InChI=1S/C23H36N2/c1-9-16(3)13-18(5)22(10-2)24-11-12-25(21(24)8)23-19(6)14-17(4)15-20(23)7/h9,13-14,20-21H,1,10-12,15H2,2-8H3/b16-13-,22-18+ |
| InChIKey | DFMYYKIBKPSOIW-YYUKJUQHSA-N |
| XLogP | 6.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|