About S-(4-iodobutyl) ethanethioate
S-(4-iodobutyl) ethanethioate (PubChem CID 90077373) has the molecular formula C6H11IOS
and a molecular weight of 258.12 g/mol. Its IUPAC name is S-(4-iodobutyl) ethanethioate.
Molecular Properties
| Compound Name | S-(4-iodobutyl) ethanethioate |
| PubChem CID | 90077373 |
| Molecular Formula | C6H11IOS |
| Molecular Weight | 258.12 g/mol |
| Exact Mass | 257.96 |
| IUPAC Name | S-(4-iodobutyl) ethanethioate |
| SMILES | CC(=O)SCCCCI |
| InChI | InChI=1S/C6H11IOS/c1-6(8)9-5-3-2-4-7/h2-5H2,1H3 |
| InChIKey | PVMBCDRJZXPPJT-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.12 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-iodobutyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-iodobutyl) ethanethioate?
The IUPAC name of S-(4-iodobutyl) ethanethioate (CID 90077373) is S-(4-iodobutyl) ethanethioate.
What is the SMILES notation for S-(4-iodobutyl) ethanethioate?
The canonical SMILES for S-(4-iodobutyl) ethanethioate is CC(=O)SCCCCI.
What is the InChIKey of S-(4-iodobutyl) ethanethioate?
The InChIKey is PVMBCDRJZXPPJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11IOS/c1-6(8)9-5-3-2-4-7/h2-5H2,1H3.
What are the key properties of S-(4-iodobutyl) ethanethioate?
S-(4-iodobutyl) ethanethioate has a molecular weight of 258.12 g/mol, XLogP of 2.48, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-iodobutyl) ethanethioate is sourced from PubChem (CID 90077373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).