About S-(2-hydroxyethyl) 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanethioate
S-(2-hydroxyethyl) 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanethioate (PubChem CID 90077400) has the molecular formula C13H28O3SSi
and a molecular weight of 292.52 g/mol. Its IUPAC name is S-(2-hydroxyethyl) 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanethioate.
Molecular Properties
| Compound Name | S-(2-hydroxyethyl) 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanethioate |
| PubChem CID | 90077400 |
| Molecular Formula | C13H28O3SSi |
| Molecular Weight | 292.52 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | S-(2-hydroxyethyl) 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanethioate |
| SMILES | CC(C)(CCC(C)(C)[Si](C)(C)O)C(=O)SCCO |
| InChI | InChI=1S/C13H28O3SSi/c1-12(2,11(15)17-10-9-14)7-8-13(3,4)18(5,6)16/h14,16H,7-10H2,1-6H3 |
| InChIKey | ZBYSMQKTQGZIEW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-hydroxyethyl) 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-hydroxyethyl) 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanethioate?
The IUPAC name of S-(2-hydroxyethyl) 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanethioate (CID 90077400) is S-(2-hydroxyethyl) 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanethioate.
What is the SMILES notation for S-(2-hydroxyethyl) 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanethioate?
The canonical SMILES for S-(2-hydroxyethyl) 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanethioate is CC(C)(CCC(C)(C)[Si](C)(C)O)C(=O)SCCO.
What is the InChIKey of S-(2-hydroxyethyl) 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanethioate?
The InChIKey is ZBYSMQKTQGZIEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O3SSi/c1-12(2,11(15)17-10-9-14)7-8-13(3,4)18(5,6)16/h14,16H,7-10H2,1-6H3.
What are the key properties of S-(2-hydroxyethyl) 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanethioate?
S-(2-hydroxyethyl) 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanethioate has a molecular weight of 292.52 g/mol, XLogP of 3.02, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-hydroxyethyl) 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanethioate is sourced from PubChem (CID 90077400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).