About 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanoic acid
5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanoic acid (PubChem CID 90077407) has the molecular formula C11H24O3Si
and a molecular weight of 232.40 g/mol. Its IUPAC name is 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanoic acid.
Molecular Properties
| Compound Name | 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanoic acid |
| PubChem CID | 90077407 |
| Molecular Formula | C11H24O3Si |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanoic acid |
| SMILES | CC(C)(CCC(C)(C)[Si](C)(C)O)C(=O)O |
| InChI | InChI=1S/C11H24O3Si/c1-10(2,9(12)13)7-8-11(3,4)15(5,6)14/h14H,7-8H2,1-6H3,(H,12,13) |
| InChIKey | FXCOFUATKZVUGG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanoic acid?
The IUPAC name of 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanoic acid (CID 90077407) is 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanoic acid.
What is the SMILES notation for 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanoic acid?
The canonical SMILES for 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanoic acid is CC(C)(CCC(C)(C)[Si](C)(C)O)C(=O)O.
What is the InChIKey of 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanoic acid?
The InChIKey is FXCOFUATKZVUGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24O3Si/c1-10(2,9(12)13)7-8-11(3,4)15(5,6)14/h14H,7-8H2,1-6H3,(H,12,13).
What are the key properties of 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanoic acid?
5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanoic acid has a molecular weight of 232.40 g/mol, XLogP of 2.86, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[hydroxy(dimethyl)silyl]-2,2,5-trimethylhexanoic acid is sourced from PubChem (CID 90077407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).