C16H9ClF3N3O2 — CID 90077540
6-chloro-4-[3-(trifluoromethyl)anilino]-1,5-naphthyridine-3-carboxylic acid (PubChem CID 90077540) has the molecular formula C16H9ClF3N3O2 and a molecular weight of 367.71 g/mol. Its IUPAC name is 6-chloro-4-[3-(trifluoromethyl)anilino]-1,5-naphthyridine-3-carboxylic acid.
| Compound Name | 6-chloro-4-[3-(trifluoromethyl)anilino]-1,5-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 90077540 |
| Molecular Formula | C16H9ClF3N3O2 |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 6-chloro-4-[3-(trifluoromethyl)anilino]-1,5-naphthyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc2ccc(Cl)nc2c1Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H9ClF3N3O2/c17-12-5-4-11-14(23-12)13(10(7-21-11)15(24)25)22-9-3-1-2-8(6-9)16(18,19)20/h1-7H,(H,21,22)(H,24,25) |
| InChIKey | IWCYJSDVRJOSEP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|