C26H20N6O4S — CID 90077544
2-methyl-2-[4-[9-(6-methylsulfonyl-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-1-yl]phenyl]propanenitrile (PubChem CID 90077544) has the molecular formula C26H20N6O4S and a molecular weight of 512.55 g/mol. Its IUPAC name is 2-methyl-2-[4-[9-(6-methylsulfonyl-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-1-yl]phenyl]propanenitrile.
| Compound Name | 2-methyl-2-[4-[9-(6-methylsulfonyl-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-1-yl]phenyl]propanenitrile |
|---|---|
| PubChem CID | 90077544 |
| Molecular Formula | C26H20N6O4S |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 2-methyl-2-[4-[9-(6-methylsulfonyl-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-1-yl]phenyl]propanenitrile |
| SMILES | CC(C)(C#N)c1ccc(-n2c(=O)[nH]c(=O)c3cnc4ccc(-c5ccc(S(C)(=O)=O)nc5)nc4c32)cc1 |
| InChI | InChI=1S/C26H20N6O4S/c1-26(2,14-27)16-5-7-17(8-6-16)32-23-18(24(33)31-25(32)34)13-28-20-10-9-19(30-22(20)23)15-4-11-21(29-12-15)37(3,35)36/h4-13H,1-3H3,(H,31,33,34) |
| InChIKey | UMGVRXLSLFOGBX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|