C18H10ClF3N4O2 — CID 90077549
9-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 90077549) has the molecular formula C18H10ClF3N4O2 and a molecular weight of 406.75 g/mol. Its IUPAC name is 9-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 90077549 |
| Molecular Formula | C18H10ClF3N4O2 |
| Molecular Weight | 406.75 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 9-chloro-3-methyl-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | Cn1c(=O)c2cnc3ccc(Cl)nc3c2n(-c2cccc(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C18H10ClF3N4O2/c1-25-16(27)11-8-23-12-5-6-13(19)24-14(12)15(11)26(17(25)28)10-4-2-3-9(7-10)18(20,21)22/h2-8H,1H3 |
| InChIKey | VCGLYWZVZUAAPL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.75 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|