C25H19N7O2 — CID 90077550
2-[4-[9-(6-amino-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-1-yl]phenyl]-2-methylpropanenitrile (PubChem CID 90077550) has the molecular formula C25H19N7O2 and a molecular weight of 449.47 g/mol. Its IUPAC name is 2-[4-[9-(6-amino-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-1-yl]phenyl]-2-methylpropanenitrile.
| Compound Name | 2-[4-[9-(6-amino-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-1-yl]phenyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 90077550 |
| Molecular Formula | C25H19N7O2 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 2-[4-[9-(6-amino-3-pyridinyl)-2,4-dioxopyrimido[5,4-c][1,5]naphthyridin-1-yl]phenyl]-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)c1ccc(-n2c(=O)[nH]c(=O)c3cnc4ccc(-c5ccc(N)nc5)nc4c32)cc1 |
| InChI | InChI=1S/C25H19N7O2/c1-25(2,13-26)15-4-6-16(7-5-15)32-22-17(23(33)31-24(32)34)12-28-19-9-8-18(30-21(19)22)14-3-10-20(27)29-11-14/h3-12H,1-2H3,(H2,27,29)(H,31,33,34) |
| InChIKey | SEOXLQPEZOFCAM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 143.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|