C26H22N6O4S — CID 90077574
1-[4-(1-imino-2-methylpropan-2-yl)phenyl]-9-(6-methylsulfonyl-3-pyridinyl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 90077574) has the molecular formula C26H22N6O4S and a molecular weight of 514.57 g/mol. Its IUPAC name is 1-[4-(1-imino-2-methylpropan-2-yl)phenyl]-9-(6-methylsulfonyl-3-pyridinyl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 1-[4-(1-imino-2-methylpropan-2-yl)phenyl]-9-(6-methylsulfonyl-3-pyridinyl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 90077574 |
| Molecular Formula | C26H22N6O4S |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 1-[4-(1-imino-2-methylpropan-2-yl)phenyl]-9-(6-methylsulfonyl-3-pyridinyl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | [H]/N=C/C(C)(C)c1ccc(-n2c(=O)[nH]c(=O)c3cnc4ccc(-c5ccc(S(C)(=O)=O)nc5)nc4c32)cc1 |
| InChI | InChI=1S/C26H22N6O4S/c1-26(2,14-27)16-5-7-17(8-6-16)32-23-18(24(33)31-25(32)34)13-28-20-10-9-19(30-22(20)23)15-4-11-21(29-12-15)37(3,35)36/h4-14,27H,1-3H3,(H,31,33,34)/b27-14+ |
| InChIKey | KAVPIRDPGDJTGY-MZJWZYIUSA-N |
| XLogP | 3.01 |
| TPSA | 151.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|