C22H23N7O4 — CID 90077580
1-[1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]-9-(1-methylpyrazol-4-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 90077580) has the molecular formula C22H23N7O4 and a molecular weight of 449.47 g/mol. Its IUPAC name is 1-[1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]-9-(1-methylpyrazol-4-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 1-[1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]-9-(1-methylpyrazol-4-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 90077580 |
| Molecular Formula | C22H23N7O4 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 1-[1-[(2S)-2-hydroxypropanoyl]piperidin-4-yl]-9-(1-methylpyrazol-4-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | C[C@H](O)C(=O)N1CCC(n2c(=O)[nH]c(=O)c3cnc4ccc(-c5cnn(C)c5)nc4c32)CC1 |
| InChI | InChI=1S/C22H23N7O4/c1-12(30)21(32)28-7-5-14(6-8-28)29-19-15(20(31)26-22(29)33)10-23-17-4-3-16(25-18(17)19)13-9-24-27(2)11-13/h3-4,9-12,14,30H,5-8H2,1-2H3,(H,26,31,33)/t12-/m0/s1 |
| InChIKey | PKGWSLJREQTSCK-LBPRGKRZSA-N |
| XLogP | 0.58 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|