C17H8ClF3N4O2 — CID 90077584
9-chloro-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 90077584) has the molecular formula C17H8ClF3N4O2 and a molecular weight of 392.72 g/mol. Its IUPAC name is 9-chloro-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-chloro-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 90077584 |
| Molecular Formula | C17H8ClF3N4O2 |
| Molecular Weight | 392.72 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 9-chloro-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2cccc(C(F)(F)F)c2)c2c1cnc1ccc(Cl)nc12 |
| InChI | InChI=1S/C17H8ClF3N4O2/c18-12-5-4-11-13(23-12)14-10(7-22-11)15(26)24-16(27)25(14)9-3-1-2-8(6-9)17(19,20)21/h1-7H,(H,24,26,27) |
| InChIKey | JMEYWQVRRZSJSC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.72 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|