C23H23N7O4S — CID 90077595
1-[1-[(2R)-2-hydroxypropanoyl]piperidin-4-yl]-9-(2-methylsulfanylpyrimidin-5-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 90077595) has the molecular formula C23H23N7O4S and a molecular weight of 493.55 g/mol. Its IUPAC name is 1-[1-[(2R)-2-hydroxypropanoyl]piperidin-4-yl]-9-(2-methylsulfanylpyrimidin-5-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 1-[1-[(2R)-2-hydroxypropanoyl]piperidin-4-yl]-9-(2-methylsulfanylpyrimidin-5-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 90077595 |
| Molecular Formula | C23H23N7O4S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 1-[1-[(2R)-2-hydroxypropanoyl]piperidin-4-yl]-9-(2-methylsulfanylpyrimidin-5-yl)pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | CSc1ncc(-c2ccc3ncc4c(=O)[nH]c(=O)n(C5CCN(C(=O)[C@@H](C)O)CC5)c4c3n2)cn1 |
| InChI | InChI=1S/C23H23N7O4S/c1-12(31)21(33)29-7-5-14(6-8-29)30-19-15(20(32)28-23(30)34)11-24-17-4-3-16(27-18(17)19)13-9-25-22(35-2)26-10-13/h3-4,9-12,14,31H,5-8H2,1-2H3,(H,28,32,34)/t12-/m1/s1 |
| InChIKey | XSXFJRZCAOPQHP-GFCCVEGCSA-N |
| XLogP | 1.36 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|