C25H16ClF3N4O3 — CID 90077618
9-chloro-3-[(4-methoxyphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 90077618) has the molecular formula C25H16ClF3N4O3 and a molecular weight of 512.88 g/mol. Its IUPAC name is 9-chloro-3-[(4-methoxyphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-chloro-3-[(4-methoxyphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 90077618 |
| Molecular Formula | C25H16ClF3N4O3 |
| Molecular Weight | 512.88 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 9-chloro-3-[(4-methoxyphenyl)methyl]-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | COc1ccc(Cn2c(=O)c3cnc4ccc(Cl)nc4c3n(-c3cccc(C(F)(F)F)c3)c2=O)cc1 |
| InChI | InChI=1S/C25H16ClF3N4O3/c1-36-17-7-5-14(6-8-17)13-32-23(34)18-12-30-19-9-10-20(26)31-21(19)22(18)33(24(32)35)16-4-2-3-15(11-16)25(27,28)29/h2-12H,13H2,1H3 |
| InChIKey | SMTQMRLJDMIBOV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.88 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|