C24H16F3N5O4 — CID 90077644
3-(hydroxymethyl)-9-(6-methoxy-3-pyridinyl)-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 90077644) has the molecular formula C24H16F3N5O4 and a molecular weight of 495.42 g/mol. Its IUPAC name is 3-(hydroxymethyl)-9-(6-methoxy-3-pyridinyl)-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 3-(hydroxymethyl)-9-(6-methoxy-3-pyridinyl)-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 90077644 |
| Molecular Formula | C24H16F3N5O4 |
| Molecular Weight | 495.42 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 3-(hydroxymethyl)-9-(6-methoxy-3-pyridinyl)-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | COc1ccc(-c2ccc3ncc4c(=O)n(CO)c(=O)n(-c5cccc(C(F)(F)F)c5)c4c3n2)cn1 |
| InChI | InChI=1S/C24H16F3N5O4/c1-36-19-8-5-13(10-29-19)17-6-7-18-20(30-17)21-16(11-28-18)22(34)31(12-33)23(35)32(21)15-4-2-3-14(9-15)24(25,26)27/h2-11,33H,12H2,1H3 |
| InChIKey | OBFPVBRQOWCLOH-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|