C24H15F3N6O4 — CID 90077729
9-(6-methoxy-3-pyridinyl)-3-(nitrosomethyl)-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione (PubChem CID 90077729) has the molecular formula C24H15F3N6O4 and a molecular weight of 508.42 g/mol. Its IUPAC name is 9-(6-methoxy-3-pyridinyl)-3-(nitrosomethyl)-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione.
| Compound Name | 9-(6-methoxy-3-pyridinyl)-3-(nitrosomethyl)-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
|---|---|
| PubChem CID | 90077729 |
| Molecular Formula | C24H15F3N6O4 |
| Molecular Weight | 508.42 g/mol |
| Exact Mass | 508.11 |
| IUPAC Name | 9-(6-methoxy-3-pyridinyl)-3-(nitrosomethyl)-1-[3-(trifluoromethyl)phenyl]pyrimido[5,4-c][1,5]naphthyridine-2,4-dione |
| SMILES | COc1ccc(-c2ccc3ncc4c(=O)n(CN=O)c(=O)n(-c5cccc(C(F)(F)F)c5)c4c3n2)cn1 |
| InChI | InChI=1S/C24H15F3N6O4/c1-37-19-8-5-13(10-29-19)17-6-7-18-20(31-17)21-16(11-28-18)22(34)32(12-30-36)23(35)33(21)15-4-2-3-14(9-15)24(25,26)27/h2-11H,12H2,1H3 |
| InChIKey | UJPSJSIMMSOCLK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 121.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|