C16H28O — CID 90077825
4-methyl-3,4,5,6,7,8,9,10,11,12,13,14-dodecahydro-2H-cyclododeca[b]pyran (PubChem CID 90077825) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is 4-methyl-3,4,5,6,7,8,9,10,11,12,13,14-dodecahydro-2H-cyclododeca[b]pyran.
| Compound Name | 4-methyl-3,4,5,6,7,8,9,10,11,12,13,14-dodecahydro-2H-cyclododeca[b]pyran |
|---|---|
| PubChem CID | 90077825 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | 4-methyl-3,4,5,6,7,8,9,10,11,12,13,14-dodecahydro-2H-cyclododeca[b]pyran |
| SMILES | CC1CCOC2=C1CCCCCCCCCC2 |
| InChI | InChI=1S/C16H28O/c1-14-12-13-17-16-11-9-7-5-3-2-4-6-8-10-15(14)16/h14H,2-13H2,1H3 |
| InChIKey | IROBGWUEPCDSJB-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |