About N-[(4R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]acetamide
N-[(4R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]acetamide (PubChem CID 90077951) has the molecular formula C9H17NO5
and a molecular weight of 219.24 g/mol. Its IUPAC name is N-[(4R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[(4R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]acetamide |
| PubChem CID | 90077951 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | N-[(4R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]acetamide |
| SMILES | CC(=O)NC1C(C)OC(CO)C(O)[C@@H]1O |
| InChI | InChI=1S/C9H17NO5/c1-4-7(10-5(2)12)9(14)8(13)6(3-11)15-4/h4,6-9,11,13-14H,3H2,1-2H3,(H,10,12)/t4?,6?,7?,8?,9-/m1/s1 |
| InChIKey | MGJDWXFUCWVFAW-MLMATEFBSA-N |
| XLogP | -2.01 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(4R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]acetamide?
The IUPAC name of N-[(4R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]acetamide (CID 90077951) is N-[(4R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]acetamide.
What is the SMILES notation for N-[(4R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]acetamide?
The canonical SMILES for N-[(4R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]acetamide is CC(=O)NC1C(C)OC(CO)C(O)[C@@H]1O.
What is the InChIKey of N-[(4R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]acetamide?
The InChIKey is MGJDWXFUCWVFAW-MLMATEFBSA-N. The full InChI is InChI=1S/C9H17NO5/c1-4-7(10-5(2)12)9(14)8(13)6(3-11)15-4/h4,6-9,11,13-14H,3H2,1-2H3,(H,10,12)/t4?,6?,7?,8?,9-/m1/s1.
What are the key properties of N-[(4R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]acetamide?
N-[(4R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]acetamide has a molecular weight of 219.24 g/mol, XLogP of -2.01, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4R)-4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]acetamide is sourced from PubChem (CID 90077951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).