C22H24BClFNO3 — CID 90077998
(2-chloro-6-fluorophenyl)-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-quinolin-1-yl]methanone (PubChem CID 90077998) has the molecular formula C22H24BClFNO3 and a molecular weight of 415.70 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-quinolin-1-yl]methanone.
| Compound Name | (2-chloro-6-fluorophenyl)-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-quinolin-1-yl]methanone |
|---|---|
| PubChem CID | 90077998 |
| Molecular Formula | C22H24BClFNO3 |
| Molecular Weight | 415.70 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | (2-chloro-6-fluorophenyl)-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-quinolin-1-yl]methanone |
| SMILES | CC1(C)OB(c2ccc3c(c2)CCCN3C(=O)c2c(F)cccc2Cl)OC1(C)C |
| InChI | InChI=1S/C22H24BClFNO3/c1-21(2)22(3,4)29-23(28-21)15-10-11-18-14(13-15)7-6-12-26(18)20(27)19-16(24)8-5-9-17(19)25/h5,8-11,13H,6-7,12H2,1-4H3 |
| InChIKey | OSDPBOWECBLVSM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.70 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|