About 1-(2-methoxyethyl)-1-(1H-1,2,4-triazol-5-yl)hydrazine
1-(2-methoxyethyl)-1-(1H-1,2,4-triazol-5-yl)hydrazine (PubChem CID 90078466) has the molecular formula C5H11N5O
and a molecular weight of 157.18 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-1-(1H-1,2,4-triazol-5-yl)hydrazine.
Molecular Properties
| Compound Name | 1-(2-methoxyethyl)-1-(1H-1,2,4-triazol-5-yl)hydrazine |
| PubChem CID | 90078466 |
| Molecular Formula | C5H11N5O |
| Molecular Weight | 157.18 g/mol |
| Exact Mass | 157.10 |
| IUPAC Name | 1-(2-methoxyethyl)-1-(1H-1,2,4-triazol-5-yl)hydrazine |
| SMILES | COCCN(N)c1ncn[nH]1 |
| InChI | InChI=1S/C5H11N5O/c1-11-3-2-10(6)5-7-4-8-9-5/h4H,2-3,6H2,1H3,(H,7,8,9) |
| InChIKey | JGKLGTOQBIRLQJ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.18 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methoxyethyl)-1-(1H-1,2,4-triazol-5-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methoxyethyl)-1-(1H-1,2,4-triazol-5-yl)hydrazine?
The IUPAC name of 1-(2-methoxyethyl)-1-(1H-1,2,4-triazol-5-yl)hydrazine (CID 90078466) is 1-(2-methoxyethyl)-1-(1H-1,2,4-triazol-5-yl)hydrazine.
What is the SMILES notation for 1-(2-methoxyethyl)-1-(1H-1,2,4-triazol-5-yl)hydrazine?
The canonical SMILES for 1-(2-methoxyethyl)-1-(1H-1,2,4-triazol-5-yl)hydrazine is COCCN(N)c1ncn[nH]1.
What is the InChIKey of 1-(2-methoxyethyl)-1-(1H-1,2,4-triazol-5-yl)hydrazine?
The InChIKey is JGKLGTOQBIRLQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N5O/c1-11-3-2-10(6)5-7-4-8-9-5/h4H,2-3,6H2,1H3,(H,7,8,9).
What are the key properties of 1-(2-methoxyethyl)-1-(1H-1,2,4-triazol-5-yl)hydrazine?
1-(2-methoxyethyl)-1-(1H-1,2,4-triazol-5-yl)hydrazine has a molecular weight of 157.18 g/mol, XLogP of -0.87, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methoxyethyl)-1-(1H-1,2,4-triazol-5-yl)hydrazine is sourced from PubChem (CID 90078466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).