C7H13F3N6 — CID 90078469
3-[amino-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]amino]-N-methylpropan-1-amine (PubChem CID 90078469) has the molecular formula C7H13F3N6 and a molecular weight of 238.22 g/mol. Its IUPAC name is 3-[amino-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]amino]-N-methylpropan-1-amine.
| Compound Name | 3-[amino-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]amino]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 90078469 |
| Molecular Formula | C7H13F3N6 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 3-[amino-[5-(trifluoromethyl)-1H-1,2,4-triazol-3-yl]amino]-N-methylpropan-1-amine |
| SMILES | CNCCCN(N)c1n[nH]c(C(F)(F)F)n1 |
| InChI | InChI=1S/C7H13F3N6/c1-12-3-2-4-16(11)6-13-5(14-15-6)7(8,9)10/h12H,2-4,11H2,1H3,(H,13,14,15) |
| InChIKey | DMOPWNHLZYPMFB-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|