C39H38F2N6O2 — CID 90078796
8-[(2-cyclopentylphenyl)methyl]-2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-fluoroanilino]-6-[2-(2-fluorophenoxy)ethynyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 90078796) has the molecular formula C39H38F2N6O2 and a molecular weight of 660.77 g/mol. Its IUPAC name is 8-[(2-cyclopentylphenyl)methyl]-2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-fluoroanilino]-6-[2-(2-fluorophenoxy)ethynyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-[(2-cyclopentylphenyl)methyl]-2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-fluoroanilino]-6-[2-(2-fluorophenoxy)ethynyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 90078796 |
| Molecular Formula | C39H38F2N6O2 |
| Molecular Weight | 660.77 g/mol |
| Exact Mass | 660.30 |
| IUPAC Name | 8-[(2-cyclopentylphenyl)methyl]-2-[4-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-fluoroanilino]-6-[2-(2-fluorophenoxy)ethynyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C[C@@H]1CN(c2ccc(Nc3ncc4cc(C#COc5ccccc5F)c(=O)n(Cc5ccccc5C5CCCC5)c4n3)cc2F)C[C@H](C)N1 |
| InChI | InChI=1S/C39H38F2N6O2/c1-25-22-46(23-26(2)43-25)35-16-15-31(20-34(35)41)44-39-42-21-30-19-28(17-18-49-36-14-8-7-13-33(36)40)38(48)47(37(30)45-39)24-29-11-5-6-12-32(29)27-9-3-4-10-27/h5-8,11-16,19-21,25-27,43H,3-4,9-10,22-24H2,1-2H3,(H,42,44,45)/t25-,26+ |
| InChIKey | LZQZHYCAWHJPMT-WMPKNSHKSA-N |
| XLogP | 7.09 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.77 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|