C30H33N7OS — CID 90078824
2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)anilino]-6-(3-methylbut-1-ynyl)-8-[(5-methyl-1,2-thiazol-4-yl)methyl]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 90078824) has the molecular formula C30H33N7OS and a molecular weight of 539.71 g/mol. Its IUPAC name is 2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)anilino]-6-(3-methylbut-1-ynyl)-8-[(5-methyl-1,2-thiazol-4-yl)methyl]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)anilino]-6-(3-methylbut-1-ynyl)-8-[(5-methyl-1,2-thiazol-4-yl)methyl]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 90078824 |
| Molecular Formula | C30H33N7OS |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | 2-[4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)anilino]-6-(3-methylbut-1-ynyl)-8-[(5-methyl-1,2-thiazol-4-yl)methyl]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1sncc1Cn1c(=O)c(C#CC(C)C)cc2cnc(Nc3ccc(N4CCN5CCCC5C4)cc3)nc21 |
| InChI | InChI=1S/C30H33N7OS/c1-20(2)6-7-22-15-23-16-31-30(34-28(23)37(29(22)38)18-24-17-32-39-21(24)3)33-25-8-10-26(11-9-25)36-14-13-35-12-4-5-27(35)19-36/h8-11,15-17,20,27H,4-5,12-14,18-19H2,1-3H3,(H,31,33,34) |
| InChIKey | SUBGLRKIZMRIFF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|