About 1-(3,6-dichloro-9,10-dihydroanthracen-9-yl)ethanol
1-(3,6-dichloro-9,10-dihydroanthracen-9-yl)ethanol (PubChem CID 90078942) has the molecular formula C16H14Cl2O
and a molecular weight of 293.19 g/mol. Its IUPAC name is 1-(3,6-dichloro-9,10-dihydroanthracen-9-yl)ethanol.
Molecular Properties
| Compound Name | 1-(3,6-dichloro-9,10-dihydroanthracen-9-yl)ethanol |
| PubChem CID | 90078942 |
| Molecular Formula | C16H14Cl2O |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 1-(3,6-dichloro-9,10-dihydroanthracen-9-yl)ethanol |
| SMILES | CC(O)C1c2ccc(Cl)cc2Cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H14Cl2O/c1-9(19)16-14-4-2-12(17)7-10(14)6-11-8-13(18)3-5-15(11)16/h2-5,7-9,16,19H,6H2,1H3 |
| InChIKey | AGXNMYXYEAPILW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3,6-dichloro-9,10-dihydroanthracen-9-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,6-dichloro-9,10-dihydroanthracen-9-yl)ethanol?
The IUPAC name of 1-(3,6-dichloro-9,10-dihydroanthracen-9-yl)ethanol (CID 90078942) is 1-(3,6-dichloro-9,10-dihydroanthracen-9-yl)ethanol.
What is the SMILES notation for 1-(3,6-dichloro-9,10-dihydroanthracen-9-yl)ethanol?
The canonical SMILES for 1-(3,6-dichloro-9,10-dihydroanthracen-9-yl)ethanol is CC(O)C1c2ccc(Cl)cc2Cc2cc(Cl)ccc21.
What is the InChIKey of 1-(3,6-dichloro-9,10-dihydroanthracen-9-yl)ethanol?
The InChIKey is AGXNMYXYEAPILW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2O/c1-9(19)16-14-4-2-12(17)7-10(14)6-11-8-13(18)3-5-15(11)16/h2-5,7-9,16,19H,6H2,1H3.
What are the key properties of 1-(3,6-dichloro-9,10-dihydroanthracen-9-yl)ethanol?
1-(3,6-dichloro-9,10-dihydroanthracen-9-yl)ethanol has a molecular weight of 293.19 g/mol, XLogP of 4.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,6-dichloro-9,10-dihydroanthracen-9-yl)ethanol is sourced from PubChem (CID 90078942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).