C22H18N4O5S3 — CID 90079025
5-[[5-[(5-methyl-6-phenyl-1,3-benzothiazol-2-yl)-methylsulfonylmethyl]-1,3,4-oxadiazol-2-yl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 90079025) has the molecular formula C22H18N4O5S3 and a molecular weight of 514.61 g/mol. Its IUPAC name is 5-[[5-[(5-methyl-6-phenyl-1,3-benzothiazol-2-yl)-methylsulfonylmethyl]-1,3,4-oxadiazol-2-yl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[5-[(5-methyl-6-phenyl-1,3-benzothiazol-2-yl)-methylsulfonylmethyl]-1,3,4-oxadiazol-2-yl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 90079025 |
| Molecular Formula | C22H18N4O5S3 |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.04 |
| IUPAC Name | 5-[[5-[(5-methyl-6-phenyl-1,3-benzothiazol-2-yl)-methylsulfonylmethyl]-1,3,4-oxadiazol-2-yl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc2nc(C(c3nnc(CC4SC(=O)NC4=O)o3)S(C)(=O)=O)sc2cc1-c1ccccc1 |
| InChI | InChI=1S/C22H18N4O5S3/c1-11-8-14-15(9-13(11)12-6-4-3-5-7-12)32-21(23-14)18(34(2,29)30)20-26-25-17(31-20)10-16-19(27)24-22(28)33-16/h3-9,16,18H,10H2,1-2H3,(H,24,27,28) |
| InChIKey | RRIYKVBETYRWPC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|