About 1,4-dimethylpiperazin-2-one;4-methylpiperazin-2-one
1,4-dimethylpiperazin-2-one;4-methylpiperazin-2-one (PubChem CID 90079623) has the molecular formula C11H22N4O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is 1,4-dimethylpiperazin-2-one;4-methylpiperazin-2-one.
Molecular Properties
| Compound Name | 1,4-dimethylpiperazin-2-one;4-methylpiperazin-2-one |
| PubChem CID | 90079623 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 1,4-dimethylpiperazin-2-one;4-methylpiperazin-2-one |
| SMILES | CN1CCN(C)C(=O)C1.CN1CCNC(=O)C1 |
| InChI | InChI=1S/C6H12N2O.C5H10N2O/c1-7-3-4-8(2)6(9)5-7;1-7-3-2-6-5(8)4-7/h3-5H2,1-2H3;2-4H2,1H3,(H,6,8) |
| InChIKey | IXWLMNALYOCKNR-UHFFFAOYSA-N |
| XLogP | -1.56 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-dimethylpiperazin-2-one;4-methylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylpiperazin-2-one;4-methylpiperazin-2-one?
The IUPAC name of 1,4-dimethylpiperazin-2-one;4-methylpiperazin-2-one (CID 90079623) is 1,4-dimethylpiperazin-2-one;4-methylpiperazin-2-one.
What is the SMILES notation for 1,4-dimethylpiperazin-2-one;4-methylpiperazin-2-one?
The canonical SMILES for 1,4-dimethylpiperazin-2-one;4-methylpiperazin-2-one is CN1CCN(C)C(=O)C1.CN1CCNC(=O)C1.
What is the InChIKey of 1,4-dimethylpiperazin-2-one;4-methylpiperazin-2-one?
The InChIKey is IXWLMNALYOCKNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C5H10N2O/c1-7-3-4-8(2)6(9)5-7;1-7-3-2-6-5(8)4-7/h3-5H2,1-2H3;2-4H2,1H3,(H,6,8).
What are the key properties of 1,4-dimethylpiperazin-2-one;4-methylpiperazin-2-one?
1,4-dimethylpiperazin-2-one;4-methylpiperazin-2-one has a molecular weight of 242.32 g/mol, XLogP of -1.56, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylpiperazin-2-one;4-methylpiperazin-2-one is sourced from PubChem (CID 90079623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).