C16H15N6O2S- — CID 90079918
cyano-[3-(5,7,8,11-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaen-13-yl)piperidin-1-yl]methanesulfinate (PubChem CID 90079918) has the molecular formula C16H15N6O2S- and a molecular weight of 355.40 g/mol. Its IUPAC name is cyano-[3-(5,7,8,11-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaen-13-yl)piperidin-1-yl]methanesulfinate.
| Compound Name | cyano-[3-(5,7,8,11-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaen-13-yl)piperidin-1-yl]methanesulfinate |
|---|---|
| PubChem CID | 90079918 |
| Molecular Formula | C16H15N6O2S- |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | cyano-[3-(5,7,8,11-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8,10,12-hexaen-13-yl)piperidin-1-yl]methanesulfinate |
| SMILES | N#CC(N1CCCC(c2cncc3nnc4[nH]ccc4c23)C1)S(=O)[O-] |
| InChI | InChI=1S/C16H16N6O2S/c17-6-14(25(23)24)22-5-1-2-10(9-22)12-7-18-8-13-15(12)11-3-4-19-16(11)21-20-13/h3-4,7-8,10,14H,1-2,5,9H2,(H,19,21)(H,23,24)/p-1 |
| InChIKey | VZUOJEPXYLBCOR-UHFFFAOYSA-M |
| XLogP | 1.41 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|